CAS 1694568-68-7 is the registry number for 2,2-Difluoro-2-(2-(trifluoromethyl)-1,3-thiazol-5-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-difluoro-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]acetic acid (CAS 1694568-68-7) is a chemical compound with the molecular formula C6H2F5NO2S and a molecular weight of 247.14 g/mol. IUPAC name: 2,2-difluoro-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]acetic acid. InChIKey: LEBSBWYGHZTJLH-UHFFFAOYSA-N.
| Molecular formula | C6H2F5NO2S |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 2,2-difluoro-2-[2-(trifluoromethyl)-1,3-thiazol-5-yl]acetic acid |
| InChIKey | LEBSBWYGHZTJLH-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)C(F)(F)F)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)