CAS 847956-10-9 is the registry number for 4-(Perfluoroethyl)thiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-2-carboxylic acid (CAS 847956-10-9) is a chemical compound with the molecular formula C6H2F5NO2S and a molecular weight of 247.14 g/mol. IUPAC name: 4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-2-carboxylic acid. InChIKey: HFZVBAWUNORZII-UHFFFAOYSA-N.
| Molecular formula | C6H2F5NO2S |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | HFZVBAWUNORZII-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C(=O)O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)