Products 169463-47-2

CAS 169463-47-2 is the registry number for Methyl 5-cyano-1-methyl-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-cyano-1-methylindole-2-carboxylate (CAS 169463-47-2) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: methyl 5-cyano-1-methylindole-2-carboxylate. InChIKey: GKUDLEFFNCYKGF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10N2O2
Molecular weight214.22 g/mol
IUPAC namemethyl 5-cyano-1-methylindole-2-carboxylate
InChIKeyGKUDLEFFNCYKGF-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)C#N)C=C1C(=O)OC

Computed by PubChem (NCBI)