CAS 169463-47-2 is the registry number for Methyl 5-cyano-1-methyl-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg.
Methyl 5-cyano-1-methylindole-2-carboxylate (CAS 169463-47-2) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: methyl 5-cyano-1-methylindole-2-carboxylate. InChIKey: GKUDLEFFNCYKGF-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | methyl 5-cyano-1-methylindole-2-carboxylate |
| InChIKey | GKUDLEFFNCYKGF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C#N)C=C1C(=O)OC |
Computed by PubChem (NCBI)