CAS 16948-39-3 appears in our catalog under these names: 4-nitrophenyl (2S)-3-(benzyloxy)-2-{[(tert-butoxy)carbonyl]amino}propanoate, 98%, Boc–Ser(Bzl)–ONp. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g.
(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoate (CAS 16948-39-3) is a chemical compound with the molecular formula C21H24N2O7 and a molecular weight of 416.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoate. InChIKey: CLAREYWIWVFFND-SFHVURJKSA-N.
| Molecular formula | C21H24N2O7 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoate |
| InChIKey | CLAREYWIWVFFND-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COCC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)