CAS 85677-93-6 appears in our catalog under these names: Nimodipine EP Impurity A, Dehydro Nimodipine, >95% (HPLC), 2-Methoxyethyl 1-Methylethyl 2,6-Dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate, 2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid isopropyl 2-methoxyethyl ester, 3-Isopropyl 5-(2-methoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate, 98%, 98%. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Chemat. Available pack sizes: on request, 500mg, 50mg, 100mg, 25mg, 250mg, 1g, 5g.
5-O-(2-methoxyethyl) 3-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 85677-93-6) is a chemical compound with the molecular formula C21H24N2O7 and a molecular weight of 416.4 g/mol. IUPAC name: 5-O-(2-methoxyethyl) 3-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: SJJUCKCPGPCJQM-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O7 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | 5-O-(2-methoxyethyl) 3-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | SJJUCKCPGPCJQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC |
Computed by PubChem (NCBI)