Products 1695209-76-7

CAS 1695209-76-7 is the registry number for 2-(2,3-Diaminophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(2,3-diaminophenyl)acetic acid (CAS 1695209-76-7) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-(2,3-diaminophenyl)acetic acid. InChIKey: FIYNNIMRGIRYEO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2
Molecular weight166.18 g/mol
IUPAC name2-(2,3-diaminophenyl)acetic acid
InChIKeyFIYNNIMRGIRYEO-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)N)N)CC(=O)O

Computed by PubChem (NCBI)