CAS 169558-97-8 is the registry number for 3-Chlorobenzyl carbamimidothioate hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-chlorophenyl)methyl carbamimidothioate;hydrobromide (CAS 169558-97-8) is a chemical compound with the molecular formula C8H10BrClN2S and a molecular weight of 281.60 g/mol. IUPAC name: (3-chlorophenyl)methyl carbamimidothioate;hydrobromide. InChIKey: MCCIIEZGQVQPDN-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2S |
|---|---|
| Molecular weight | 281.60 g/mol |
| IUPAC name | (3-chlorophenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | MCCIIEZGQVQPDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CSC(=N)N.Br |
Computed by PubChem (NCBI)