CAS 90732-58-4 is the registry number for 4-Chlorobenzyl carbamimidothioate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)methyl carbamimidothioate;hydrobromide (CAS 90732-58-4) is a chemical compound with the molecular formula C8H10BrClN2S and a molecular weight of 281.60 g/mol. IUPAC name: (4-chlorophenyl)methyl carbamimidothioate;hydrobromide. InChIKey: XZGYFCWZQGBICU-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2S |
|---|---|
| Molecular weight | 281.60 g/mol |
| IUPAC name | (4-chlorophenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | XZGYFCWZQGBICU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC(=N)N)Cl.Br |
Computed by PubChem (NCBI)