CAS 169559-01-7 appears in our catalog under these names: {((1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)methyl)sulfanyl}methanimidamide hydrochloride, 95%, {((1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)methyl)sulfanyl}methanimidamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(1,3-dioxoisoindol-2-yl)methyl carbamimidothioate;hydrochloride (CAS 169559-01-7) is a chemical compound with the molecular formula C10H10ClN3O2S and a molecular weight of 271.72 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl)methyl carbamimidothioate;hydrochloride. InChIKey: CHELGSYECLLSSX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O2S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl)methyl carbamimidothioate;hydrochloride |
| InChIKey | CHELGSYECLLSSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CSC(=N)N.Cl |
Computed by PubChem (NCBI)