CAS 1909310-07-1 appears in our catalog under these names: 3-Cyclopropyl-1-methyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonyl chloride, 95%, 3-Cyclopropyl-1-methyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-cyclopropyl-1-methylpyrazolo[3,4-b]pyridine-5-sulfonyl chloride (CAS 1909310-07-1) is a chemical compound with the molecular formula C10H10ClN3O2S and a molecular weight of 271.72 g/mol. IUPAC name: 3-cyclopropyl-1-methylpyrazolo[3,4-b]pyridine-5-sulfonyl chloride. InChIKey: BIZMBPHPIVCWLD-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O2S |
|---|---|
| Molecular weight | 271.72 g/mol |
| IUPAC name | 3-cyclopropyl-1-methylpyrazolo[3,4-b]pyridine-5-sulfonyl chloride |
| InChIKey | BIZMBPHPIVCWLD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=N2)S(=O)(=O)Cl)C(=N1)C3CC3 |
Computed by PubChem (NCBI)