CAS 1695922-53-2 appears in our catalog under these names: 2-Bromo-n-(3-chloro-4-fluorobenzyl)propanamide, 95%, 2-Bromo-N-(3-chloro-4-fluorobenzyl)propanamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-N-[(3-chloro-4-fluorophenyl)methyl]propanamide (CAS 1695922-53-2) is a chemical compound with the molecular formula C10H10BrClFNO and a molecular weight of 294.55 g/mol. IUPAC name: 2-bromo-N-[(3-chloro-4-fluorophenyl)methyl]propanamide. InChIKey: IMTMCWVXBHZHIK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClFNO |
|---|---|
| Molecular weight | 294.55 g/mol |
| IUPAC name | 2-bromo-N-[(3-chloro-4-fluorophenyl)methyl]propanamide |
| InChIKey | IMTMCWVXBHZHIK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NCC1=CC(=C(C=C1)F)Cl)Br |
Computed by PubChem (NCBI)