CAS 2768871-06-1 is the registry number for 4-Bromo-3-chloro-2-fluoro-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-3-chloro-2-fluoro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine (CAS 2768871-06-1) is a chemical compound with the molecular formula C10H10BrClFNO and a molecular weight of 294.55 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluoro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine. InChIKey: CPZXJLYWJBBOJG-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClFNO |
|---|---|
| Molecular weight | 294.55 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluoro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| InChIKey | CPZXJLYWJBBOJG-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(CO1)C(=C(C(=N2)F)Cl)Br)C |
Computed by PubChem (NCBI)