Products 1697047-18-9
CAS 1697047-18-9 is the registry number for 2-([(Benzyloxy)carbonyl]amino)-3-(5-fluoropyridin-3-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(5-fluoro-3-pyridinyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1697047-18-9) is a chemical compound with the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. IUPAC name: 3-(5-fluoro-3-pyridinyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: LIMRIPJRXKLDBZ-UHFFFAOYSA-N.
| Molecular formula | C16H15FN2O4 |
|---|---|
| Molecular weight | 318.30 g/mol |
| IUPAC name | 3-(5-fluoro-3-pyridinyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | LIMRIPJRXKLDBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC2=CC(=CN=C2)F)C(=O)O |
Computed by PubChem (NCBI)