CAS 425613-09-8 appears in our catalog under these names: Sj000291942, 95%, SJ000291942/ 99.07% (existing batch purity), SJ000291942, SJ000291942 99%, 2-(4-Ethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 250mg.
2-(4-ethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide (CAS 425613-09-8) is a chemical compound with the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. IUPAC name: 2-(4-ethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide. InChIKey: YSZJLXPXVFGTNK-UHFFFAOYSA-N.
| Molecular formula | C16H15FN2O4 |
|---|---|
| Molecular weight | 318.30 g/mol |
| IUPAC name | 2-(4-ethylphenoxy)-N-(4-fluoro-3-nitrophenyl)acetamide |
| InChIKey | YSZJLXPXVFGTNK-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)OCC(=O)NC2=CC(=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)