Products 169736-84-9
CAS 169736-84-9 is the registry number for (S)-2-((1,1'-Biphenyl)-2-yloxy)propanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-(2-phenylphenoxy)propanoic acid (CAS 169736-84-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: (2S)-2-(2-phenylphenoxy)propanoic acid. InChIKey: LHACJRMZSJGCFY-NSHDSACASA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | (2S)-2-(2-phenylphenoxy)propanoic acid |
| InChIKey | LHACJRMZSJGCFY-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)O)OC1=CC=CC=C1C2=CC=CC=C2 |
Computed by PubChem (NCBI)