Products 1697694-79-3
CAS 1697694-79-3 is the registry number for 5-(Propan-2-yl)-3-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-propan-2-yl-3-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid (CAS 1697694-79-3) is a chemical compound with the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. IUPAC name: 5-propan-2-yl-3-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid. InChIKey: BQNWINHZGMPNSU-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3 |
|---|---|
| Molecular weight | 223.15 g/mol |
| IUPAC name | 5-propan-2-yl-3-(trifluoromethyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | BQNWINHZGMPNSU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NO1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)