Products 654-85-3
CAS 654-85-3 is the registry number for ethyl 2-methyl-5-(trifluoromethyl)oxazole-4-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylate (CAS 654-85-3) is a chemical compound with the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. IUPAC name: ethyl 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylate. InChIKey: LZPNPKUTEBIRPQ-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO3 |
|---|---|
| Molecular weight | 223.15 g/mol |
| IUPAC name | ethyl 2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylate |
| InChIKey | LZPNPKUTEBIRPQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C)C(F)(F)F |
Computed by PubChem (NCBI)