CAS 169776-04-9 appears in our catalog under these names: 6-Fluorobenzo[d]thiazole-2-carbonitrile 97%, 6-Fluorobenzo[d]thiazole-2-carbonitrile, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-fluoro-1,3-benzothiazole-2-carbonitrile (CAS 169776-04-9) is a chemical compound with the molecular formula C8H3FN2S and a molecular weight of 178.19 g/mol. IUPAC name: 6-fluoro-1,3-benzothiazole-2-carbonitrile. InChIKey: YMDVORKXEAGKDD-UHFFFAOYSA-N.
| Molecular formula | C8H3FN2S |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 6-fluoro-1,3-benzothiazole-2-carbonitrile |
| InChIKey | YMDVORKXEAGKDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)SC(=N2)C#N |
Computed by PubChem (NCBI)