CAS 2117417-23-7 is the registry number for 7-Fluorobenzo[d]thiazole-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-fluoro-1,3-benzothiazole-4-carbonitrile (CAS 2117417-23-7) is a chemical compound with the molecular formula C8H3FN2S and a molecular weight of 178.19 g/mol. IUPAC name: 7-fluoro-1,3-benzothiazole-4-carbonitrile. InChIKey: MHGYEVSYAKWSGG-UHFFFAOYSA-N.
| Molecular formula | C8H3FN2S |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 7-fluoro-1,3-benzothiazole-4-carbonitrile |
| InChIKey | MHGYEVSYAKWSGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1C#N)N=CS2)F |
Computed by PubChem (NCBI)