CAS 1698028-22-6 appears in our catalog under these names: 4-Bromo-2-fluoro-6-nitrobenzaldehyde 95%, 4-Bromo-2-fluoro-6-nitrobenzaldehyde, 98%, 4-Bromo-2-fluoro-6-nitrobenzaldehyde, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-bromo-2-fluoro-6-nitrobenzaldehyde (CAS 1698028-22-6) is a chemical compound with the molecular formula C7H3BrFNO3 and a molecular weight of 248.01 g/mol. IUPAC name: 4-bromo-2-fluoro-6-nitrobenzaldehyde. InChIKey: IKIBCVVUGNCJEZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO3 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-6-nitrobenzaldehyde |
| InChIKey | IKIBCVVUGNCJEZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])C=O)F)Br |
Computed by PubChem (NCBI)