Products 1805421-10-6
CAS 1805421-10-6 appears in our catalog under these names: 2-Bromo-4-fluoro-6-nitrobenzaldehyde 97%, 2-Bromo-4-fluoro-6-nitrobenzaldehyde, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-4-fluoro-6-nitrobenzaldehyde (CAS 1805421-10-6) is a chemical compound with the molecular formula C7H3BrFNO3 and a molecular weight of 248.01 g/mol. IUPAC name: 2-bromo-4-fluoro-6-nitrobenzaldehyde. InChIKey: AOOUVFUUXFPADH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO3 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | 2-bromo-4-fluoro-6-nitrobenzaldehyde |
| InChIKey | AOOUVFUUXFPADH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])C=O)Br)F |
Computed by PubChem (NCBI)