CAS 1699249-56-3 appears in our catalog under these names: 4,6,7-Trifluoro-1H-indole-2-carboxylic acid 97%, 4,6,7-Trifluoro-1H-indole-2-carboxylic acid, 97%, 97%, 4,6,7-TRIFLUORO-1H-INDOLE-2-CARBOXYLIC ACID, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50g, 10g, 25g, 100g.
4,6,7-trifluoro-1H-indole-2-carboxylic acid (CAS 1699249-56-3) is a chemical compound with the molecular formula C9H4F3NO2 and a molecular weight of 215.13 g/mol. IUPAC name: 4,6,7-trifluoro-1H-indole-2-carboxylic acid. InChIKey: FDONAEMTXHBAJT-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO2 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 4,6,7-trifluoro-1H-indole-2-carboxylic acid |
| InChIKey | FDONAEMTXHBAJT-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1F)F)NC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)