Products 1699750-17-8
CAS 1699750-17-8 is the registry number for N-[2-Nitro-5-(trifluoromethyl)phenyl]aminoacetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[2-nitro-5-(trifluoromethyl)anilino]acetic acid (CAS 1699750-17-8) is a chemical compound with the molecular formula C9H7F3N2O4 and a molecular weight of 264.16 g/mol. IUPAC name: 2-[2-nitro-5-(trifluoromethyl)anilino]acetic acid. InChIKey: FLJQZHNYJYSJPI-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O4 |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | 2-[2-nitro-5-(trifluoromethyl)anilino]acetic acid |
| InChIKey | FLJQZHNYJYSJPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)