CAS 875155-19-4 is the registry number for Methyl 2-amino-5-nitro-4-(trifluoromethyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-amino-5-nitro-4-(trifluoromethyl)benzoate (CAS 875155-19-4) is a chemical compound with the molecular formula C9H7F3N2O4 and a molecular weight of 264.16 g/mol. IUPAC name: methyl 2-amino-5-nitro-4-(trifluoromethyl)benzoate. InChIKey: YPFUHFOLSYLYNX-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O4 |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | methyl 2-amino-5-nitro-4-(trifluoromethyl)benzoate |
| InChIKey | YPFUHFOLSYLYNX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)