CAS 1699971-24-8 appears in our catalog under these names: tert-Butyl (3-((4-methyl-2-nitrophenyl)amino)propyl)carbamate, 95%, tert–Butyl (3–((4–methyl–2–nitrophenyl)amino)propyl)carbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl N-[3-(4-methyl-2-nitroanilino)propyl]carbamate (CAS 1699971-24-8) is a chemical compound with the molecular formula C15H23N3O4 and a molecular weight of 309.36 g/mol. IUPAC name: tert-butyl N-[3-(4-methyl-2-nitroanilino)propyl]carbamate. InChIKey: QCRVVXPPOKMTBT-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O4 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | tert-butyl N-[3-(4-methyl-2-nitroanilino)propyl]carbamate |
| InChIKey | QCRVVXPPOKMTBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NCCCNC(=O)OC(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)