CAS 852617-12-0 appears in our catalog under these names: 2,6-Di-(boc-amino)pyridine, 98%, 2,6-DI-(BOC-AMINO)PYRIDINE, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Tert-butyl N-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]carbamate (CAS 852617-12-0) is a chemical compound with the molecular formula C15H23N3O4 and a molecular weight of 309.36 g/mol. IUPAC name: tert-butyl N-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]carbamate. InChIKey: QVPCQNKHMFGPLW-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O4 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | tert-butyl N-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]carbamate |
| InChIKey | QVPCQNKHMFGPLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)