CAS 170111-43-0 is the registry number for (S)-Hphvsph hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-amine;hydrochloride (CAS 170111-43-0) is a chemical compound with the molecular formula C17H20ClNO2S and a molecular weight of 337.9 g/mol. IUPAC name: (E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-amine;hydrochloride. InChIKey: SRGXYAGPHWUYGO-SHFDOEPXSA-N.
| Molecular formula | C17H20ClNO2S |
|---|---|
| Molecular weight | 337.9 g/mol |
| IUPAC name | (E,3S)-1-(benzenesulfonyl)-5-phenylpent-1-en-3-amine;hydrochloride |
| InChIKey | SRGXYAGPHWUYGO-SHFDOEPXSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@@H](/C=C/S(=O)(=O)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)