CAS 4561-11-9 is the registry number for S-Benzyl-L-cysteine benzyl ester hydrochloride. Offered by: Creative Peptides. Available pack sizes: on request.
Benzyl (2R)-2-amino-3-benzylsulfanylpropanoate;hydrochloride (CAS 4561-11-9) is a chemical compound with the molecular formula C17H20ClNO2S and a molecular weight of 337.9 g/mol. IUPAC name: benzyl (2R)-2-amino-3-benzylsulfanylpropanoate;hydrochloride. InChIKey: SKFOKVOZXZYMAU-NTISSMGPSA-N.
| Molecular formula | C17H20ClNO2S |
|---|---|
| Molecular weight | 337.9 g/mol |
| IUPAC name | benzyl (2R)-2-amino-3-benzylsulfanylpropanoate;hydrochloride |
| InChIKey | SKFOKVOZXZYMAU-NTISSMGPSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CSCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)