Products 170138-17-7
CAS 170138-17-7 is the registry number for Midkine (Human). Offered by: Biosynth. Available pack sizes: 50ug.
2-(2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)acetic acid (CAS 170138-17-7) is a chemical compound with the molecular formula C17H14O3 and a molecular weight of 266.29 g/mol. IUPAC name: 2-(2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)acetic acid. InChIKey: OYUDOANJBAWBBO-UHFFFAOYSA-N.
| Molecular formula | C17H14O3 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 2-(2-oxo-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)acetic acid |
| InChIKey | OYUDOANJBAWBBO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)CC(=O)O)C(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)