CAS 1701629-91-5 is the registry number for N-(4-Bromo-3-chlorophenyl)aminosulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-bromo-2-chloro-4-(sulfamoylamino)benzene (CAS 1701629-91-5) is a chemical compound with the molecular formula C6H6BrClN2O2S and a molecular weight of 285.55 g/mol. IUPAC name: 1-bromo-2-chloro-4-(sulfamoylamino)benzene. InChIKey: GYISKCLXSRTZKE-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClN2O2S |
|---|---|
| Molecular weight | 285.55 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-(sulfamoylamino)benzene |
| InChIKey | GYISKCLXSRTZKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NS(=O)(=O)N)Cl)Br |
Computed by PubChem (NCBI)