CAS 622814-92-0 is the registry number for 5-Bromo-6-chloro-N-methylpyridine-3-sulfonamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-6-chloro-N-methylpyridine-3-sulfonamide (CAS 622814-92-0) is a chemical compound with the molecular formula C6H6BrClN2O2S and a molecular weight of 285.55 g/mol. IUPAC name: 5-bromo-6-chloro-N-methylpyridine-3-sulfonamide. InChIKey: FFBIWYSUENAJKB-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClN2O2S |
|---|---|
| Molecular weight | 285.55 g/mol |
| IUPAC name | 5-bromo-6-chloro-N-methylpyridine-3-sulfonamide |
| InChIKey | FFBIWYSUENAJKB-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(N=C1)Cl)Br |
Computed by PubChem (NCBI)