Products 1701817-32-4
CAS 1701817-32-4 is the registry number for 8-Bromo-7-chloro-1,4-dihydroquinolin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-bromo-7-chloro-1H-quinolin-4-one (CAS 1701817-32-4) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 8-bromo-7-chloro-1H-quinolin-4-one. InChIKey: KPDJATQYPDOPPS-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 8-bromo-7-chloro-1H-quinolin-4-one |
| InChIKey | KPDJATQYPDOPPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C=CN2)Br)Cl |
Computed by PubChem (NCBI)