Products 17019-01-1
CAS 17019-01-1 appears in our catalog under these names: Tetrahydroharmine, >95% (HPLC), Tetrahydroharmine, Tetrahydroharmine/ 100%, tetrahydro–Harmine, (±)-Tetrahydroharmine, 99.98% ,, 99.98% ,. Offered by: TRC, Mikromol, LoGiCal, TargetMol, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 100mg, 25 mg, 10 mg, 5 mg.
7-methoxy-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (CAS 17019-01-1) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: 7-methoxy-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole. InChIKey: ZXLDQJLIBNPEFJ-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 7-methoxy-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| InChIKey | ZXLDQJLIBNPEFJ-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CCN1)C3=C(N2)C=C(C=C3)OC |
Computed by PubChem (NCBI)