Products 170227-64-2
CAS 170227-64-2 appears in our catalog under these names: N,N-Dimethyl-his-ome, 95%, N,N-Dimethyl-L-histidine Methyl Ester, N,N-Dimethyl-histidine methyl ester, 95+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 100mg, 2,5g, 50mg.
Methyl (2S)-2-(dimethylamino)-3-(1H-imidazol-5-yl)propanoate (CAS 170227-64-2) is a chemical compound with the molecular formula C9H15N3O2 and a molecular weight of 197.23 g/mol. IUPAC name: methyl (2S)-2-(dimethylamino)-3-(1H-imidazol-5-yl)propanoate. InChIKey: CDIYETQVUKDKFP-QMMMGPOBSA-N.
| Molecular formula | C9H15N3O2 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | methyl (2S)-2-(dimethylamino)-3-(1H-imidazol-5-yl)propanoate |
| InChIKey | CDIYETQVUKDKFP-QMMMGPOBSA-N |
| SMILES | CN(C)[C@@H](CC1=CN=CN1)C(=O)OC |
Computed by PubChem (NCBI)