CAS 170235-50-4 is the registry number for 4-(4-Chlorophenyl)-5-phenyl-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-(4-chlorophenyl)-3-phenyl-1H-1,2,4-triazole-5-thione (CAS 170235-50-4) is a chemical compound with the molecular formula C14H10ClN3S and a molecular weight of 287.8 g/mol. IUPAC name: 4-(4-chlorophenyl)-3-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: BEDFJTQEZDYYHT-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3S |
|---|---|
| Molecular weight | 287.8 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-3-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | BEDFJTQEZDYYHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)N2C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)