CAS 93300-54-0 appears in our catalog under these names: 5-(4-Chlorophenyl)-4-phenyl-4H-1,2,4-triazole-3-thiol, 95%, 95%, 5-(4-Chloro-phenyl)-4-phenyl-4H-[1,2,4]triazole-3-thiol. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-(4-chlorophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 93300-54-0) is a chemical compound with the molecular formula C14H10ClN3S and a molecular weight of 287.8 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: AJOJIGWGJWZBOB-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3S |
|---|---|
| Molecular weight | 287.8 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | AJOJIGWGJWZBOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)