Products 1702390-71-3
CAS 1702390-71-3 is the registry number for 3-(3,3-Difluorocyclohexyl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,3-difluorocyclohexyl)prop-2-ynoic acid (CAS 1702390-71-3) is a chemical compound with the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. IUPAC name: 3-(3,3-difluorocyclohexyl)prop-2-ynoic acid. InChIKey: HBLYHXODUWMNQR-UHFFFAOYSA-N.
| Molecular formula | C9H10F2O2 |
|---|---|
| Molecular weight | 188.17 g/mol |
| IUPAC name | 3-(3,3-difluorocyclohexyl)prop-2-ynoic acid |
| InChIKey | HBLYHXODUWMNQR-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)(F)F)C#CC(=O)O |
Computed by PubChem (NCBI)