Products 1702437-90-8
CAS 1702437-90-8 is the registry number for (2-Amino-4-chlorophenyl)(tetrahydro-2H-pyran-3-yl)-methanone. Offered by: TRC. Available pack sizes: 250mg.
(2-amino-4-chlorophenyl)-(oxan-3-yl)methanone (CAS 1702437-90-8) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: (2-amino-4-chlorophenyl)-(oxan-3-yl)methanone. InChIKey: VALKJXLEEVOACY-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | (2-amino-4-chlorophenyl)-(oxan-3-yl)methanone |
| InChIKey | VALKJXLEEVOACY-UHFFFAOYSA-N |
| SMILES | C1CC(COC1)C(=O)C2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)