CAS 1702854-56-5 is the registry number for 6-Chloro-4-iodobenzo[d]thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-iodo-1,3-benzothiazol-2-amine (CAS 1702854-56-5) is a chemical compound with the molecular formula C7H4ClIN2S and a molecular weight of 310.54 g/mol. IUPAC name: 6-chloro-4-iodo-1,3-benzothiazol-2-amine. InChIKey: HQMQFNHUNXQLBL-UHFFFAOYSA-N.
| Molecular formula | C7H4ClIN2S |
|---|---|
| Molecular weight | 310.54 g/mol |
| IUPAC name | 6-chloro-4-iodo-1,3-benzothiazol-2-amine |
| InChIKey | HQMQFNHUNXQLBL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)N)I)Cl |
Computed by PubChem (NCBI)