CAS 1823372-30-0 appears in our catalog under these names: 4-Chloro-6-iodo-5-methylthieno[2,3-d]pyrimidine, 95%, 4–Chloro–6–iodo–5–methylthieno(2,3–d)pyrimidine, 4-Chloro-6-iodo-5-methylthieno(2,3-d)pyrimidine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 10g, 5g.
4-chloro-6-iodo-5-methylthieno[2,3-d]pyrimidine (CAS 1823372-30-0) is a chemical compound with the molecular formula C7H4ClIN2S and a molecular weight of 310.54 g/mol. IUPAC name: 4-chloro-6-iodo-5-methylthieno[2,3-d]pyrimidine. InChIKey: USZQKEUGHQKFAR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClIN2S |
|---|---|
| Molecular weight | 310.54 g/mol |
| IUPAC name | 4-chloro-6-iodo-5-methylthieno[2,3-d]pyrimidine |
| InChIKey | USZQKEUGHQKFAR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC=N2)Cl)I |
Computed by PubChem (NCBI)