Products 1703-48-6
CAS 1703-48-6 is the registry number for Dimabefylline. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[[4-(dimethylamino)phenyl]methyl]-1,3-dimethylpurine-2,6-dione (CAS 1703-48-6) is a chemical compound with the molecular formula C16H19N5O2 and a molecular weight of 313.35 g/mol. IUPAC name: 7-[[4-(dimethylamino)phenyl]methyl]-1,3-dimethylpurine-2,6-dione. InChIKey: VUCZRCBQVXTIIV-UHFFFAOYSA-N.
| Molecular formula | C16H19N5O2 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | 7-[[4-(dimethylamino)phenyl]methyl]-1,3-dimethylpurine-2,6-dione |
| InChIKey | VUCZRCBQVXTIIV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC3=CC=C(C=C3)N(C)C |
Computed by PubChem (NCBI)