Products 23946-37-4
CAS 23946-37-4 is the registry number for N1-Ethyl-N1-(4-((4-nitrophenyl)diazenyl)phenyl)ethane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-ethyl-N'-[4-[(4-nitrophenyl)diazenyl]phenyl]ethane-1,2-diamine (CAS 23946-37-4) is a chemical compound with the molecular formula C16H19N5O2 and a molecular weight of 313.35 g/mol. IUPAC name: N'-ethyl-N'-[4-[(4-nitrophenyl)diazenyl]phenyl]ethane-1,2-diamine. InChIKey: FSQJIWXKYDUEEP-UHFFFAOYSA-N.
| Molecular formula | C16H19N5O2 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | N'-ethyl-N'-[4-[(4-nitrophenyl)diazenyl]phenyl]ethane-1,2-diamine |
| InChIKey | FSQJIWXKYDUEEP-UHFFFAOYSA-N |
| SMILES | CCN(CCN)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)