CAS 1703757-22-5 appears in our catalog under these names: n-Propyltriphenylphosphonium-d5 Bromide, n-Propyl-2,2,3,3,3-d5-triphenylphosphonium Bromide, 98 atom % D, min 98% Chemical Purity, Triphenyl(propyl)phosphonium-d5 (bromide), 99%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 1g, 250mg, 25mg, 0,5g, 10 mg, 50 mg, 25 mg, 100 mg.
2,2,3,3,3-pentadeuteriopropyl(triphenyl)phosphanium bromide (CAS 1703757-22-5) is a chemical compound with the molecular formula C21H22BrP and a molecular weight of 390.3 g/mol. IUPAC name: 2,2,3,3,3-pentadeuteriopropyl(triphenyl)phosphanium bromide. InChIKey: XMQSELBBYSAURN-LUIAAVAXSA-M.
| Molecular formula | C21H22BrP |
|---|---|
| Molecular weight | 390.3 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuteriopropyl(triphenyl)phosphanium bromide |
| InChIKey | XMQSELBBYSAURN-LUIAAVAXSA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)