CAS 170382-33-9 is the registry number for 2,4-Dibromobenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dibromobenzohydrazide (CAS 170382-33-9) is a chemical compound with the molecular formula C7H6Br2N2O and a molecular weight of 293.94 g/mol. IUPAC name: 2,4-dibromobenzohydrazide. InChIKey: XOAHTOQIWOEHLK-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2O |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 2,4-dibromobenzohydrazide |
| InChIKey | XOAHTOQIWOEHLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)C(=O)NN |
Computed by PubChem (NCBI)