CAS 874774-34-2 appears in our catalog under these names: 4-Amino-3,5-dibromobenzamide, 95%, 4-Amino-3,5-dibromobenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-amino-3,5-dibromobenzamide (CAS 874774-34-2) is a chemical compound with the molecular formula C7H6Br2N2O and a molecular weight of 293.94 g/mol. IUPAC name: 4-amino-3,5-dibromobenzamide. InChIKey: BLOWNZBZNOMDFY-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2O |
|---|---|
| Molecular weight | 293.94 g/mol |
| IUPAC name | 4-amino-3,5-dibromobenzamide |
| InChIKey | BLOWNZBZNOMDFY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C(=O)N |
Computed by PubChem (NCBI)