Products 1703834-47-2
CAS 1703834-47-2 is the registry number for N-[1,1′:3′,1′′-Terphenyl]-4′-yl-9-phenanthrenamine, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
N-(2,4-diphenylphenyl)phenanthren-9-amine (CAS 1703834-47-2) is a chemical compound with the molecular formula C32H23N and a molecular weight of 421.5 g/mol. IUPAC name: N-(2,4-diphenylphenyl)phenanthren-9-amine. InChIKey: MXJLFHKBCAICEF-UHFFFAOYSA-N.
| Molecular formula | C32H23N |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | N-(2,4-diphenylphenyl)phenanthren-9-amine |
| InChIKey | MXJLFHKBCAICEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)NC3=CC4=CC=CC=C4C5=CC=CC=C53)C6=CC=CC=C6 |
Computed by PubChem (NCBI)