CAS 1704069-68-0 is the registry number for 3–Fluoro–4–(4–oxopiperidine–1 –carbonyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-fluoro-4-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid (CAS 1704069-68-0) is a chemical compound with the molecular formula C12H13BFNO4 and a molecular weight of 265.05 g/mol. IUPAC name: [3-fluoro-4-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: MSAKQRLCLGEWNN-UHFFFAOYSA-N.
| Molecular formula | C12H13BFNO4 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | [3-fluoro-4-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | MSAKQRLCLGEWNN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N2CCC(=O)CC2)F)(O)O |
Computed by PubChem (NCBI)