CAS 1704082-33-6 is the registry number for (4–fluoro–3–(4–oxopiperidine–1–carbonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-fluoro-3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid (CAS 1704082-33-6) is a chemical compound with the molecular formula C12H13BFNO4 and a molecular weight of 265.05 g/mol. IUPAC name: [4-fluoro-3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: ASBOLDUVESIHEQ-UHFFFAOYSA-N.
| Molecular formula | C12H13BFNO4 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | [4-fluoro-3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | ASBOLDUVESIHEQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)N2CCC(=O)CC2)(O)O |
Computed by PubChem (NCBI)