CAS 1704069-70-4 is the registry number for (3–Morpholino–5–(trifluoromethyl) phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]boronic acid (CAS 1704069-70-4) is a chemical compound with the molecular formula C11H13BF3NO3 and a molecular weight of 275.03 g/mol. IUPAC name: [3-morpholin-4-yl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: DBIDUCJSVMWKJT-UHFFFAOYSA-N.
| Molecular formula | C11H13BF3NO3 |
|---|---|
| Molecular weight | 275.03 g/mol |
| IUPAC name | [3-morpholin-4-yl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | DBIDUCJSVMWKJT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N2CCOCC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)