Products 2225174-23-0
CAS 2225174-23-0 is the registry number for (4–morpholino–2–(trifluoromethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]boronic acid (CAS 2225174-23-0) is a chemical compound with the molecular formula C11H13BF3NO3 and a molecular weight of 275.03 g/mol. IUPAC name: [4-morpholin-4-yl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: CCNOSSGHFUOKSL-UHFFFAOYSA-N.
| Molecular formula | C11H13BF3NO3 |
|---|---|
| Molecular weight | 275.03 g/mol |
| IUPAC name | [4-morpholin-4-yl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | CCNOSSGHFUOKSL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCOCC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)